C30H38N6O2 — CID 58001057
N-(2-aminophenyl)-4-[[[4-(dimethylamino)phenyl]carbamoyl-[(1-ethylpyrrolidin-2-yl)methyl]amino]methyl]benzamide (PubChem CID 58001057) has the molecular formula C30H38N6O2 and a molecular weight of 514.67 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[4-(dimethylamino)phenyl]carbamoyl-[(1-ethylpyrrolidin-2-yl)methyl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[4-(dimethylamino)phenyl]carbamoyl-[(1-ethylpyrrolidin-2-yl)methyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 58001057 |
| Molecular Formula | C30H38N6O2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[4-(dimethylamino)phenyl]carbamoyl-[(1-ethylpyrrolidin-2-yl)methyl]amino]methyl]benzamide |
| SMILES | CCN1CCCC1CN(Cc1ccc(C(=O)Nc2ccccc2N)cc1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C30H38N6O2/c1-4-35-19-7-8-26(35)21-36(30(38)32-24-15-17-25(18-16-24)34(2)3)20-22-11-13-23(14-12-22)29(37)33-28-10-6-5-9-27(28)31/h5-6,9-18,26H,4,7-8,19-21,31H2,1-3H3,(H,32,38)(H,33,37) |
| InChIKey | REUBUWMMISDQGA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|