C22H28N4O3 — CID 68850756
methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-(1-methylpiperidin-3-yl)carbamate (PubChem CID 68850756) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-(1-methylpiperidin-3-yl)carbamate.
| Compound Name | methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-(1-methylpiperidin-3-yl)carbamate |
|---|---|
| PubChem CID | 68850756 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-(1-methylpiperidin-3-yl)carbamate |
| SMILES | COC(=O)N(Cc1ccc(C(=O)Nc2ccccc2N)cc1)C1CCCN(C)C1 |
| InChI | InChI=1S/C22H28N4O3/c1-25-13-5-6-18(15-25)26(22(28)29-2)14-16-9-11-17(12-10-16)21(27)24-20-8-4-3-7-19(20)23/h3-4,7-12,18H,5-6,13-15,23H2,1-2H3,(H,24,27) |
| InChIKey | WVFQEIAVZCOIQX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|