C21H22N4O7S — CID 68850450
methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-pyridin-3-ylcarbamate;sulfuric acid (PubChem CID 68850450) has the molecular formula C21H22N4O7S and a molecular weight of 474.50 g/mol. Its IUPAC name is methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-pyridin-3-ylcarbamate;sulfuric acid.
| Compound Name | methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-pyridin-3-ylcarbamate;sulfuric acid |
|---|---|
| PubChem CID | 68850450 |
| Molecular Formula | C21H22N4O7S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | methyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-pyridin-3-ylcarbamate;sulfuric acid |
| SMILES | COC(=O)N(Cc1ccc(C(=O)Nc2ccccc2N)cc1)c1cccnc1.O=S(=O)(O)O |
| InChI | InChI=1S/C21H20N4O3.H2O4S/c1-28-21(27)25(17-5-4-12-23-13-17)14-15-8-10-16(11-9-15)20(26)24-19-7-3-2-6-18(19)22;1-5(2,3)4/h2-13H,14,22H2,1H3,(H,24,26);(H2,1,2,3,4) |
| InChIKey | QVCRGTJQPZERHQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 172.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|