C21H21ClN4O3 — CID 87384192
N-(2-aminophenyl)-4-[[formyl(pyridin-3-ylmethoxy)amino]methyl]benzamide;hydrochloride (PubChem CID 87384192) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[formyl(pyridin-3-ylmethoxy)amino]methyl]benzamide;hydrochloride.
| Compound Name | N-(2-aminophenyl)-4-[[formyl(pyridin-3-ylmethoxy)amino]methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 87384192 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-(2-aminophenyl)-4-[[formyl(pyridin-3-ylmethoxy)amino]methyl]benzamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1NC(=O)c1ccc(CN(C=O)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C21H20N4O3.ClH/c22-19-5-1-2-6-20(19)24-21(27)18-9-7-16(8-10-18)13-25(15-26)28-14-17-4-3-11-23-12-17;/h1-12,15H,13-14,22H2,(H,24,27);1H |
| InChIKey | FHNYUNGHGDQEKQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|