C20H20N4O5S — CID 87384675
(2-aminophenyl)-[4-[[formyl(pyridin-3-ylmethoxy)amino]methyl]phenyl]sulfamic acid (PubChem CID 87384675) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is (2-aminophenyl)-[4-[[formyl(pyridin-3-ylmethoxy)amino]methyl]phenyl]sulfamic acid.
| Compound Name | (2-aminophenyl)-[4-[[formyl(pyridin-3-ylmethoxy)amino]methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 87384675 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (2-aminophenyl)-[4-[[formyl(pyridin-3-ylmethoxy)amino]methyl]phenyl]sulfamic acid |
| SMILES | Nc1ccccc1N(c1ccc(CN(C=O)OCc2cccnc2)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C20H20N4O5S/c21-19-5-1-2-6-20(19)24(30(26,27)28)18-9-7-16(8-10-18)13-23(15-25)29-14-17-4-3-11-22-12-17/h1-12,15H,13-14,21H2,(H,26,27,28) |
| InChIKey | UAJGYEHLQZFMRT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|