About 3-benzylpyridine;formic acid
3-benzylpyridine;formic acid (PubChem CID 174503454) has the molecular formula C13H13NO2
and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-benzylpyridine;formic acid.
Molecular Properties
| Compound Name | 3-benzylpyridine;formic acid |
| PubChem CID | 174503454 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-benzylpyridine;formic acid |
| SMILES | O=CO.c1ccc(Cc2cccnc2)cc1 |
| InChI | InChI=1S/C12H11N.CH2O2/c1-2-5-11(6-3-1)9-12-7-4-8-13-10-12;2-1-3/h1-8,10H,9H2;1H,(H,2,3) |
| InChIKey | MARKVFDOSKYMEY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-benzylpyridine;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylpyridine;formic acid?
The IUPAC name of 3-benzylpyridine;formic acid (CID 174503454) is 3-benzylpyridine;formic acid.
What is the SMILES notation for 3-benzylpyridine;formic acid?
The canonical SMILES for 3-benzylpyridine;formic acid is O=CO.c1ccc(Cc2cccnc2)cc1.
What is the InChIKey of 3-benzylpyridine;formic acid?
The InChIKey is MARKVFDOSKYMEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.CH2O2/c1-2-5-11(6-3-1)9-12-7-4-8-13-10-12;2-1-3/h1-8,10H,9H2;1H,(H,2,3).
What are the key properties of 3-benzylpyridine;formic acid?
3-benzylpyridine;formic acid has a molecular weight of 215.25 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylpyridine;formic acid is sourced from PubChem (CID 174503454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).