3-benzylpyridine;formic acid

C13H13NO2 — CID 174503454

IUPAC3-benzylpyridine;formic acid
SMILESO=CO.c1ccc(Cc2cccnc2)cc1
InChIInChI=1S/C12H11N.CH2O2/c1-2-5-11(6-3-1)9-12-7-4-8-13-10-12;2-1-3/h1-8,10H,9H2;1H,(H,2,3)
InChIKeyMARKVFDOSKYMEY-UHFFFAOYSA-N
MW215.25 g/mol
LogP2.37
Rot. Bonds2

About 3-benzylpyridine;formic acid

3-benzylpyridine;formic acid (PubChem CID 174503454) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-benzylpyridine;formic acid.

Molecular Properties

Compound Name3-benzylpyridine;formic acid
PubChem CID174503454
Molecular FormulaC13H13NO2
Molecular Weight215.25 g/mol
Exact Mass215.09
IUPAC Name3-benzylpyridine;formic acid
SMILESO=CO.c1ccc(Cc2cccnc2)cc1
InChIInChI=1S/C12H11N.CH2O2/c1-2-5-11(6-3-1)9-12-7-4-8-13-10-12;2-1-3/h1-8,10H,9H2;1H,(H,2,3)
InChIKeyMARKVFDOSKYMEY-UHFFFAOYSA-N
XLogP2.37
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.25
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 3-benzylpyridine;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-benzylpyridine;formic acid?
The IUPAC name of 3-benzylpyridine;formic acid (CID 174503454) is 3-benzylpyridine;formic acid.
What is the SMILES notation for 3-benzylpyridine;formic acid?
The canonical SMILES for 3-benzylpyridine;formic acid is O=CO.c1ccc(Cc2cccnc2)cc1.
What is the InChIKey of 3-benzylpyridine;formic acid?
The InChIKey is MARKVFDOSKYMEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.CH2O2/c1-2-5-11(6-3-1)9-12-7-4-8-13-10-12;2-1-3/h1-8,10H,9H2;1H,(H,2,3).
What are the key properties of 3-benzylpyridine;formic acid?
3-benzylpyridine;formic acid has a molecular weight of 215.25 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylpyridine;formic acid is sourced from PubChem (CID 174503454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).