C7H7LiNO2 — CID 66868100
CID 66868100 (PubChem CID 66868100) has the molecular formula C7H7LiNO2 and a molecular weight of 144.08 g/mol.
| Compound Name | CID 66868100 |
|---|---|
| PubChem CID | 66868100 |
| Molecular Formula | C7H7LiNO2 |
| Molecular Weight | 144.08 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | — |
| SMILES | O=C(O)Cc1cccnc1.[Li] |
| InChI | InChI=1S/C7H7NO2.Li/c9-7(10)4-6-2-1-3-8-5-6;/h1-3,5H,4H2,(H,9,10); |
| InChIKey | ZZMHIOZGDUZCMC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.08 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |