2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid

C12H11N3O3S — CID 62688977

IUPAC2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(NC(=O)Cc2cccnc2)n1
InChIInChI=1S/C12H11N3O3S/c16-10(4-8-2-1-3-13-6-8)15-12-14-9(7-19-12)5-11(17)18/h1-3,6-7H,4-5H2,(H,17,18)(H,14,15,16)
InChIKeyJMSVZSITDHPJMM-UHFFFAOYSA-N
MW277.31 g/mol
LogP1.35
Rot. Bonds5

About 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid

2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 62688977) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid
PubChem CID62688977
Molecular FormulaC12H11N3O3S
Molecular Weight277.31 g/mol
Exact Mass277.05
IUPAC Name2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(NC(=O)Cc2cccnc2)n1
InChIInChI=1S/C12H11N3O3S/c16-10(4-8-2-1-3-13-6-8)15-12-14-9(7-19-12)5-11(17)18/h1-3,6-7H,4-5H2,(H,17,18)(H,14,15,16)
InChIKeyJMSVZSITDHPJMM-UHFFFAOYSA-N
XLogP1.35
TPSA92.18 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.31
LogP ≤ 51.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid (CID 62688977) is 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid is O=C(O)Cc1csc(NC(=O)Cc2cccnc2)n1.
What is the InChIKey of 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid?
The InChIKey is JMSVZSITDHPJMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O3S/c16-10(4-8-2-1-3-13-6-8)15-12-14-9(7-19-12)5-11(17)18/h1-3,6-7H,4-5H2,(H,17,18)(H,14,15,16).
What are the key properties of 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid?
2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid has a molecular weight of 277.31 g/mol, XLogP of 1.35, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 62688977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).