C12H11N3O3S — CID 134384658
2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-5-yl]acetic acid (PubChem CID 134384658) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 134384658 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[2-[(2-pyridin-3-ylacetyl)amino]-1,3-thiazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1cnc(NC(=O)Cc2cccnc2)s1 |
| InChI | InChI=1S/C12H11N3O3S/c16-10(4-8-2-1-3-13-6-8)15-12-14-7-9(19-12)5-11(17)18/h1-3,6-7H,4-5H2,(H,17,18)(H,14,15,16) |
| InChIKey | IHEOSZXDDMXIAS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |