C8H7N3O3S — CID 86062633
2-[2-[(2-cyanoacetyl)amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 86062633) has the molecular formula C8H7N3O3S and a molecular weight of 225.23 g/mol. Its IUPAC name is 2-[2-[(2-cyanoacetyl)amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[(2-cyanoacetyl)amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 86062633 |
| Molecular Formula | C8H7N3O3S |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 2-[2-[(2-cyanoacetyl)amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | N#CCC(=O)Nc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C8H7N3O3S/c9-2-1-6(12)11-8-10-5(4-15-8)3-7(13)14/h4H,1,3H2,(H,13,14)(H,10,11,12) |
| InChIKey | UJSGVINTBZPCST-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |