2-(2-formamido-1,3-thiazol-4-yl)acetic acid

C6H6N2O3S — CID 11286886

IUPAC2-(2-formamido-1,3-thiazol-4-yl)acetic acid
SMILESO=CNc1nc(CC(=O)O)cs1
InChIInChI=1S/C6H6N2O3S/c9-3-7-6-8-4(2-12-6)1-5(10)11/h2-3H,1H2,(H,10,11)(H,7,8,9)
InChIKeyMXBRIEOXXKWWCE-UHFFFAOYSA-N
MW186.19 g/mol
LogP0.34
Rot. Bonds4

About 2-(2-formamido-1,3-thiazol-4-yl)acetic acid

2-(2-formamido-1,3-thiazol-4-yl)acetic acid (PubChem CID 11286886) has the molecular formula C6H6N2O3S and a molecular weight of 186.19 g/mol. Its IUPAC name is 2-(2-formamido-1,3-thiazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(2-formamido-1,3-thiazol-4-yl)acetic acid
PubChem CID11286886
Molecular FormulaC6H6N2O3S
Molecular Weight186.19 g/mol
Exact Mass186.01
IUPAC Name2-(2-formamido-1,3-thiazol-4-yl)acetic acid
SMILESO=CNc1nc(CC(=O)O)cs1
InChIInChI=1S/C6H6N2O3S/c9-3-7-6-8-4(2-12-6)1-5(10)11/h2-3H,1H2,(H,10,11)(H,7,8,9)
InChIKeyMXBRIEOXXKWWCE-UHFFFAOYSA-N
XLogP0.34
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.19
LogP ≤ 50.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-(2-formamido-1,3-thiazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-formamido-1,3-thiazol-4-yl)acetic acid?
The IUPAC name of 2-(2-formamido-1,3-thiazol-4-yl)acetic acid (CID 11286886) is 2-(2-formamido-1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for 2-(2-formamido-1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for 2-(2-formamido-1,3-thiazol-4-yl)acetic acid is O=CNc1nc(CC(=O)O)cs1.
What is the InChIKey of 2-(2-formamido-1,3-thiazol-4-yl)acetic acid?
The InChIKey is MXBRIEOXXKWWCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3S/c9-3-7-6-8-4(2-12-6)1-5(10)11/h2-3H,1H2,(H,10,11)(H,7,8,9).
What are the key properties of 2-(2-formamido-1,3-thiazol-4-yl)acetic acid?
2-(2-formamido-1,3-thiazol-4-yl)acetic acid has a molecular weight of 186.19 g/mol, XLogP of 0.34, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-formamido-1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 11286886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).