C14H12N2O4S — CID 43354576
2-[2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 43354576) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 2-[2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 43354576 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-[2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NC(=O)/C=C/c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C14H12N2O4S/c17-11-4-1-9(2-5-11)3-6-12(18)16-14-15-10(8-21-14)7-13(19)20/h1-6,8,17H,7H2,(H,19,20)(H,15,16,18)/b6-3+ |
| InChIKey | FFSRCKOEQPVPKA-ZZXKWVIFSA-N |
| XLogP | 2.13 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|