C14H10Cl2N2O3S — CID 45387882
2-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 45387882) has the molecular formula C14H10Cl2N2O3S and a molecular weight of 357.22 g/mol. Its IUPAC name is 2-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 45387882 |
| Molecular Formula | C14H10Cl2N2O3S |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 2-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NC(=O)/C=C/c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H10Cl2N2O3S/c15-10-3-1-8(5-11(10)16)2-4-12(19)18-14-17-9(7-22-14)6-13(20)21/h1-5,7H,6H2,(H,20,21)(H,17,18,19)/b4-2+ |
| InChIKey | QIEQZBMKYZSLPN-DUXPYHPUSA-N |
| XLogP | 3.73 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|