C23H38N2O3S — CID 173274566
2-[2-[[(E)-18-oxooctadec-9-enyl]amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 173274566) has the molecular formula C23H38N2O3S and a molecular weight of 422.64 g/mol. Its IUPAC name is 2-[2-[[(E)-18-oxooctadec-9-enyl]amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[[(E)-18-oxooctadec-9-enyl]amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 173274566 |
| Molecular Formula | C23H38N2O3S |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 2-[2-[[(E)-18-oxooctadec-9-enyl]amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=CCCCCCCC/C=C/CCCCCCCCNc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C23H38N2O3S/c26-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-24-23-25-21(20-29-23)19-22(27)28/h1-2,18,20H,3-17,19H2,(H,24,25)(H,27,28)/b2-1+ |
| InChIKey | NXNOGKAPYYNCSH-OWOJBTEDSA-N |
| XLogP | 6.40 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|