C11H20N2OS — CID 103918134
6-[(4-ethyl-1,3-thiazol-2-yl)amino]hexan-1-ol (PubChem CID 103918134) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 6-[(4-ethyl-1,3-thiazol-2-yl)amino]hexan-1-ol.
| Compound Name | 6-[(4-ethyl-1,3-thiazol-2-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 103918134 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 6-[(4-ethyl-1,3-thiazol-2-yl)amino]hexan-1-ol |
| SMILES | CCc1csc(NCCCCCCO)n1 |
| InChI | InChI=1S/C11H20N2OS/c1-2-10-9-15-11(13-10)12-7-5-3-4-6-8-14/h9,14H,2-8H2,1H3,(H,12,13) |
| InChIKey | HXAMCHLUNGPQLX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|