C9H18N4S — CID 84761937
N-[4-(aminomethyl)-1,3-thiazol-2-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 84761937) has the molecular formula C9H18N4S and a molecular weight of 214.34 g/mol. Its IUPAC name is N-[4-(aminomethyl)-1,3-thiazol-2-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[4-(aminomethyl)-1,3-thiazol-2-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 84761937 |
| Molecular Formula | C9H18N4S |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N-[4-(aminomethyl)-1,3-thiazol-2-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(CN)cs1 |
| InChI | InChI=1S/C9H18N4S/c1-13(2)5-3-4-11-9-12-8(6-10)7-14-9/h7H,3-6,10H2,1-2H3,(H,11,12) |
| InChIKey | ISKMUEPSYTWLPE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|