About 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid
2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 104527655) has the molecular formula C11H20N4O2S
and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid |
| PubChem CID | 104527655 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CN(C)CCCCNc1nc(C(N)C(=O)O)cs1 |
| InChI | InChI=1S/C11H20N4O2S/c1-15(2)6-4-3-5-13-11-14-8(7-18-11)9(12)10(16)17/h7,9H,3-6,12H2,1-2H3,(H,13,14)(H,16,17) |
| InChIKey | WFNXWAUQMLDAPF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid (CID 104527655) is 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid is CN(C)CCCCNc1nc(C(N)C(=O)O)cs1.
What is the InChIKey of 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid?
The InChIKey is WFNXWAUQMLDAPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O2S/c1-15(2)6-4-3-5-13-11-14-8(7-18-11)9(12)10(16)17/h7,9H,3-6,12H2,1-2H3,(H,13,14)(H,16,17).
What are the key properties of 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid?
2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid has a molecular weight of 272.37 g/mol, XLogP of 0.98, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[2-[4-(dimethylamino)butylamino]-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 104527655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).