C9H16ClN3S — CID 83152296
N-(4-chloro-1,3-thiazol-2-yl)-N',N'-dimethylbutane-1,4-diamine (PubChem CID 83152296) has the molecular formula C9H16ClN3S and a molecular weight of 233.77 g/mol. Its IUPAC name is N-(4-chloro-1,3-thiazol-2-yl)-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-(4-chloro-1,3-thiazol-2-yl)-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 83152296 |
| Molecular Formula | C9H16ClN3S |
| Molecular Weight | 233.77 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-(4-chloro-1,3-thiazol-2-yl)-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CN(C)CCCCNc1nc(Cl)cs1 |
| InChI | InChI=1S/C9H16ClN3S/c1-13(2)6-4-3-5-11-9-12-8(10)7-14-9/h7H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | PBJDYWDYWPIWEK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.77 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|