C10H16ClN3O2S — CID 114518206
tert-butyl N-[2-[(4-chloro-1,3-thiazol-2-yl)amino]ethyl]carbamate (PubChem CID 114518206) has the molecular formula C10H16ClN3O2S and a molecular weight of 277.78 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-chloro-1,3-thiazol-2-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-chloro-1,3-thiazol-2-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 114518206 |
| Molecular Formula | C10H16ClN3O2S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | tert-butyl N-[2-[(4-chloro-1,3-thiazol-2-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1nc(Cl)cs1 |
| InChI | InChI=1S/C10H16ClN3O2S/c1-10(2,3)16-9(15)13-5-4-12-8-14-7(11)6-17-8/h6H,4-5H2,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | FUVKIFGOQAMTBU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|