C10H17N3O2S — CID 115595638
tert-butyl N-[2-(1,3-thiazol-2-ylamino)ethyl]carbamate (PubChem CID 115595638) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is tert-butyl N-[2-(1,3-thiazol-2-ylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(1,3-thiazol-2-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 115595638 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | tert-butyl N-[2-(1,3-thiazol-2-ylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1nccs1 |
| InChI | InChI=1S/C10H17N3O2S/c1-10(2,3)15-9(14)13-5-4-11-8-12-6-7-16-8/h6-7H,4-5H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | AFYXVXYSJZYBHW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|