C15H26N4O4S — CID 57081685
tert-butyl N-[5-(methoxyamino)-6-oxo-6-(1,3-thiazol-2-ylamino)hexyl]carbamate (PubChem CID 57081685) has the molecular formula C15H26N4O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is tert-butyl N-[5-(methoxyamino)-6-oxo-6-(1,3-thiazol-2-ylamino)hexyl]carbamate.
| Compound Name | tert-butyl N-[5-(methoxyamino)-6-oxo-6-(1,3-thiazol-2-ylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 57081685 |
| Molecular Formula | C15H26N4O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | tert-butyl N-[5-(methoxyamino)-6-oxo-6-(1,3-thiazol-2-ylamino)hexyl]carbamate |
| SMILES | CONC(CCCCNC(=O)OC(C)(C)C)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C15H26N4O4S/c1-15(2,3)23-14(21)17-8-6-5-7-11(19-22-4)12(20)18-13-16-9-10-24-13/h9-11,19H,5-8H2,1-4H3,(H,17,21)(H,16,18,20) |
| InChIKey | GZPOBXROHCPYID-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|