C29H36N4O5S — CID 59028964
benzyl N-[(2S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]heptan-2-yl]carbamate (PubChem CID 59028964) has the molecular formula C29H36N4O5S and a molecular weight of 552.70 g/mol. Its IUPAC name is benzyl N-[(2S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]heptan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]heptan-2-yl]carbamate |
|---|---|
| PubChem CID | 59028964 |
| Molecular Formula | C29H36N4O5S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | benzyl N-[(2S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]heptan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C29H36N4O5S/c1-29(2,3)38-27(35)30-18-12-6-11-17-23(32-28(36)37-19-21-13-7-4-8-14-21)25(34)33-26-31-24(20-39-26)22-15-9-5-10-16-22/h4-5,7-10,13-16,20,23H,6,11-12,17-19H2,1-3H3,(H,30,35)(H,32,36)(H,31,33,34)/t23-/m0/s1 |
| InChIKey | YKBGDLKOVMRWNE-QHCPKHFHSA-N |
| XLogP | 6.13 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|