C22H30N4O5S — CID 73031692
tert-butyl N-[8-(hydroxyamino)-1,8-dioxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]octan-2-yl]carbamate (PubChem CID 73031692) has the molecular formula C22H30N4O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is tert-butyl N-[8-(hydroxyamino)-1,8-dioxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]octan-2-yl]carbamate.
| Compound Name | tert-butyl N-[8-(hydroxyamino)-1,8-dioxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]octan-2-yl]carbamate |
|---|---|
| PubChem CID | 73031692 |
| Molecular Formula | C22H30N4O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | tert-butyl N-[8-(hydroxyamino)-1,8-dioxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]octan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCCCC(=O)NO)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H30N4O5S/c1-22(2,3)31-21(29)24-16(12-8-5-9-13-18(27)26-30)19(28)25-20-23-17(14-32-20)15-10-6-4-7-11-15/h4,6-7,10-11,14,16,30H,5,8-9,12-13H2,1-3H3,(H,24,29)(H,26,27)(H,23,25,28) |
| InChIKey | SIEDPBNPFXFOSX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|