C35H38N4O5S — CID 59028995
tert-butyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]hexan-2-yl]carbamate (PubChem CID 59028995) has the molecular formula C35H38N4O5S and a molecular weight of 626.78 g/mol. Its IUPAC name is tert-butyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59028995 |
| Molecular Formula | C35H38N4O5S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | tert-butyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C35H38N4O5S/c1-35(2,3)44-34(42)38-29(31(40)39-32-37-30(22-45-32)23-13-5-4-6-14-23)19-11-12-20-36-33(41)43-21-28-26-17-9-7-15-24(26)25-16-8-10-18-27(25)28/h4-10,13-18,22,28-29H,11-12,19-21H2,1-3H3,(H,36,41)(H,38,42)(H,37,39,40)/t29-/m0/s1 |
| InChIKey | HLVNOQZFFWASPI-LJAQVGFWSA-N |
| XLogP | 7.35 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|