C38H42N6O5 — CID 122216774
tert-butyl N-[(2S)-1-[4-[(4-aminophenyl)diazenyl]anilino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 122216774) has the molecular formula C38H42N6O5 and a molecular weight of 662.79 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[4-[(4-aminophenyl)diazenyl]anilino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[4-[(4-aminophenyl)diazenyl]anilino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 122216774 |
| Molecular Formula | C38H42N6O5 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.32 |
| IUPAC Name | tert-butyl N-[(2S)-1-[4-[(4-aminophenyl)diazenyl]anilino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Nc1ccc(/N=N/c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C38H42N6O5/c1-38(2,3)49-37(47)42-34(35(45)41-26-19-21-28(22-20-26)44-43-27-17-15-25(39)16-18-27)14-8-9-23-40-36(46)48-24-33-31-12-6-4-10-29(31)30-11-5-7-13-32(30)33/h4-7,10-13,15-22,33-34H,8-9,14,23-24,39H2,1-3H3,(H,40,46)(H,41,45)(H,42,47)/b44-43+/t34-/m0/s1 |
| InChIKey | PWMTXJHYSZWMTE-PTMQZNIRSA-N |
| XLogP | 8.23 |
| TPSA | 156.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|