C30H39N3O5S2 — CID 162391345
tert-butyl N-[(2S)-1-(dithian-4-ylamino)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 162391345) has the molecular formula C30H39N3O5S2 and a molecular weight of 585.79 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(dithian-4-ylamino)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(dithian-4-ylamino)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 162391345 |
| Molecular Formula | C30H39N3O5S2 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | tert-butyl N-[(2S)-1-(dithian-4-ylamino)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC1CCSSC1 |
| InChI | InChI=1S/C30H39N3O5S2/c1-30(2,3)38-29(36)33-26(27(34)32-20-15-17-39-40-19-20)14-8-9-16-31-28(35)37-18-25-23-12-6-4-10-21(23)22-11-5-7-13-24(22)25/h4-7,10-13,20,25-26H,8-9,14-19H2,1-3H3,(H,31,35)(H,32,34)(H,33,36)/t20?,26-/m0/s1 |
| InChIKey | SWWRRCVNJFMDRG-GHZUAHJPSA-N |
| XLogP | 5.86 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|