C32H35N3O6 — CID 172908447
prop-2-enyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[4-(hydroxymethyl)anilino]-1-oxohexan-2-yl]carbamate (PubChem CID 172908447) has the molecular formula C32H35N3O6 and a molecular weight of 557.65 g/mol. Its IUPAC name is prop-2-enyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[4-(hydroxymethyl)anilino]-1-oxohexan-2-yl]carbamate.
| Compound Name | prop-2-enyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[4-(hydroxymethyl)anilino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 172908447 |
| Molecular Formula | C32H35N3O6 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | prop-2-enyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[4-(hydroxymethyl)anilino]-1-oxohexan-2-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C32H35N3O6/c1-2-19-40-32(39)35-29(30(37)34-23-16-14-22(20-36)15-17-23)13-7-8-18-33-31(38)41-21-28-26-11-5-3-9-24(26)25-10-4-6-12-27(25)28/h2-6,9-12,14-17,28-29,36H,1,7-8,13,18-21H2,(H,33,38)(H,34,37)(H,35,39)/t29-/m0/s1 |
| InChIKey | FMDQLHRQTSVFCX-LJAQVGFWSA-N |
| XLogP | 5.11 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|