C37H44N4O7 — CID 155783827
prop-2-enyl N-[(5S)-5-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-6-[4-(hydroxymethyl)anilino]-6-oxohexyl]carbamate (PubChem CID 155783827) has the molecular formula C37H44N4O7 and a molecular weight of 656.78 g/mol. Its IUPAC name is prop-2-enyl N-[(5S)-5-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-6-[4-(hydroxymethyl)anilino]-6-oxohexyl]carbamate.
| Compound Name | prop-2-enyl N-[(5S)-5-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-6-[4-(hydroxymethyl)anilino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 155783827 |
| Molecular Formula | C37H44N4O7 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | prop-2-enyl N-[(5S)-5-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-6-[4-(hydroxymethyl)anilino]-6-oxohexyl]carbamate |
| SMILES | C=CCOC(=O)NCCCC[C@H](NC(=O)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C37H44N4O7/c1-4-21-47-36(45)38-20-10-9-15-32(34(43)39-26-18-16-25(22-42)17-19-26)40-35(44)33(24(2)3)41-37(46)48-23-31-29-13-7-5-11-27(29)28-12-6-8-14-30(28)31/h4-8,11-14,16-19,24,31-33,42H,1,9-10,15,20-23H2,2-3H3,(H,38,45)(H,39,43)(H,40,44)(H,41,46)/t32-,33-/m0/s1 |
| InChIKey | RNBSTWSPPOMAGU-LQJZCPKCSA-N |
| XLogP | 5.25 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|