C39H45N5O8 — CID 169013557
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl [(3Z)-penta-1,3-dien-2-yl] carbonate (PubChem CID 169013557) has the molecular formula C39H45N5O8 and a molecular weight of 711.82 g/mol. Its IUPAC name is [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl [(3Z)-penta-1,3-dien-2-yl] carbonate.
| Compound Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl [(3Z)-penta-1,3-dien-2-yl] carbonate |
|---|---|
| PubChem CID | 169013557 |
| Molecular Formula | C39H45N5O8 |
| Molecular Weight | 711.82 g/mol |
| Exact Mass | 711.33 |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl [(3Z)-penta-1,3-dien-2-yl] carbonate |
| SMILES | C=C(/C=C\C)OC(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(C)C)cc1 |
| InChI | InChI=1S/C39H45N5O8/c1-5-11-25(4)52-39(49)51-22-26-17-19-27(20-18-26)42-35(45)33(16-10-21-41-37(40)47)43-36(46)34(24(2)3)44-38(48)50-23-32-30-14-8-6-12-28(30)29-13-7-9-15-31(29)32/h5-9,11-15,17-20,24,32-34H,4,10,16,21-23H2,1-3H3,(H,42,45)(H,43,46)(H,44,48)(H3,40,41,47)/b11-5-/t33-,34-/m0/s1 |
| InChIKey | SQPXZDKHCAHUKI-LVLMXRHPSA-N |
| XLogP | 5.86 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.82 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|