C35H45N7O8 — CID 137034083
propan-2-yl (2S)-2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]-6-diazo-5-oxohexanoate (PubChem CID 137034083) has the molecular formula C35H45N7O8 and a molecular weight of 691.79 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]-6-diazo-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]-6-diazo-5-oxohexanoate |
|---|---|
| PubChem CID | 137034083 |
| Molecular Formula | C35H45N7O8 |
| Molecular Weight | 691.79 g/mol |
| Exact Mass | 691.33 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]-6-diazo-5-oxohexanoate |
| SMILES | CC(C)OC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C |
| InChI | InChI=1S/C35H45N7O8/c1-20(2)30(42-35(48)49-19-27-25-12-7-5-10-23(25)24-11-6-8-13-26(24)27)32(45)40-28(14-9-17-38-34(36)47)31(44)41-29(33(46)50-21(3)4)16-15-22(43)18-39-37/h5-8,10-13,18,20-21,27-30H,9,14-17,19H2,1-4H3,(H,40,45)(H,41,44)(H,42,48)(H3,36,38,47)/t28-,29-,30-/m0/s1 |
| InChIKey | MFSQWJVBHRNRQE-DTXPUJKBSA-N |
| XLogP | 2.57 |
| TPSA | 231.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.79 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|