C22H38N6O6 — CID 138524467
propan-2-yl 2-[[6-acetamido-2-[(2-amino-3-methylbutanoyl)amino]hexanoyl]amino]-6-diazo-5-oxohexanoate (PubChem CID 138524467) has the molecular formula C22H38N6O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is propan-2-yl 2-[[6-acetamido-2-[(2-amino-3-methylbutanoyl)amino]hexanoyl]amino]-6-diazo-5-oxohexanoate.
| Compound Name | propan-2-yl 2-[[6-acetamido-2-[(2-amino-3-methylbutanoyl)amino]hexanoyl]amino]-6-diazo-5-oxohexanoate |
|---|---|
| PubChem CID | 138524467 |
| Molecular Formula | C22H38N6O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | propan-2-yl 2-[[6-acetamido-2-[(2-amino-3-methylbutanoyl)amino]hexanoyl]amino]-6-diazo-5-oxohexanoate |
| SMILES | CC(=O)NCCCCC(NC(=O)C(N)C(C)C)C(=O)NC(CCC(=O)C=[N+]=[N-])C(=O)OC(C)C |
| InChI | InChI=1S/C22H38N6O6/c1-13(2)19(23)21(32)27-17(8-6-7-11-25-15(5)29)20(31)28-18(22(33)34-14(3)4)10-9-16(30)12-26-24/h12-14,17-19H,6-11,23H2,1-5H3,(H,25,29)(H,27,32)(H,28,31) |
| InChIKey | MYODMBQJYVWTNI-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 193.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|