C25H43N5O6 — CID 166106066
propan-2-yl (2S,6E)-2-[[(2S)-6-acetamido-2-(octanoylamino)hexanoyl]amino]-6-diazo-5-oxohexanoate (PubChem CID 166106066) has the molecular formula C25H43N5O6 and a molecular weight of 509.65 g/mol. Its IUPAC name is propan-2-yl (2S,6E)-2-[[(2S)-6-acetamido-2-(octanoylamino)hexanoyl]amino]-6-diazo-5-oxohexanoate.
| Compound Name | propan-2-yl (2S,6E)-2-[[(2S)-6-acetamido-2-(octanoylamino)hexanoyl]amino]-6-diazo-5-oxohexanoate |
|---|---|
| PubChem CID | 166106066 |
| Molecular Formula | C25H43N5O6 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.32 |
| IUPAC Name | propan-2-yl (2S,6E)-2-[[(2S)-6-acetamido-2-(octanoylamino)hexanoyl]amino]-6-diazo-5-oxohexanoate |
| SMILES | CCCCCCCC(=O)N[C@@H](CCCCNC(C)=O)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)OC(C)C |
| InChI | InChI=1S/C25H43N5O6/c1-5-6-7-8-9-13-23(33)29-21(12-10-11-16-27-19(4)31)24(34)30-22(25(35)36-18(2)3)15-14-20(32)17-28-26/h17-18,21-22H,5-16H2,1-4H3,(H,27,31)(H,29,33)(H,30,34)/t21-,22-/m0/s1 |
| InChIKey | NHBRZEKMLNGYNW-VXKWHMMOSA-N |
| XLogP | 2.22 |
| TPSA | 167.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|