C30H41N7O7 — CID 150929164
propan-2-yl 2-[[6-acetamido-2-[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate (PubChem CID 150929164) has the molecular formula C30H41N7O7 and a molecular weight of 611.70 g/mol. Its IUPAC name is propan-2-yl 2-[[6-acetamido-2-[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate.
| Compound Name | propan-2-yl 2-[[6-acetamido-2-[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate |
|---|---|
| PubChem CID | 150929164 |
| Molecular Formula | C30H41N7O7 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | propan-2-yl 2-[[6-acetamido-2-[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate |
| SMILES | CC(=O)NCCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(C)=O)C(=O)NC(CCC(=O)C=[N+]=[N-])C(=O)OC(C)C |
| InChI | InChI=1S/C30H41N7O7/c1-18(2)44-30(43)26(13-12-22(40)17-34-31)37-28(41)25(11-7-8-14-32-19(3)38)36-29(42)27(35-20(4)39)15-21-16-33-24-10-6-5-9-23(21)24/h5-6,9-10,16-18,25-27,33H,7-8,11-15H2,1-4H3,(H,32,38)(H,35,39)(H,36,42)(H,37,41) |
| InChIKey | LFQNOHGWERDFMN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 211.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|