C22H28N3O4+ — CID 161297068
[(5S)-5-[[(2S)-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium (PubChem CID 161297068) has the molecular formula C22H28N3O4+ and a molecular weight of 398.48 g/mol. Its IUPAC name is [(5S)-5-[[(2S)-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium.
| Compound Name | [(5S)-5-[[(2S)-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium |
|---|---|
| PubChem CID | 161297068 |
| Molecular Formula | C22H28N3O4+ |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [(5S)-5-[[(2S)-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium |
| SMILES | C=[N+]=CC(=O)CC[C@H](NC(=O)[C@@H](C)Cc1c[nH]c2ccccc12)C(=O)OC(C)C |
| InChI | InChI=1S/C22H27N3O4/c1-14(2)29-22(28)20(10-9-17(26)13-23-4)25-21(27)15(3)11-16-12-24-19-8-6-5-7-18(16)19/h5-8,12-15,20,24H,4,9-11H2,1-3H3/p+1/t15-,20-/m0/s1 |
| InChIKey | XJTNPQFNSDHNHU-YWZLYKJASA-O |
| XLogP | 1.97 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|