C25H35N3O5S — CID 167000634
propan-2-yl (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(2-propan-2-yloxyethylsulfanyl)propanoyl]amino]-5-oxohexanoate (PubChem CID 167000634) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is propan-2-yl (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(2-propan-2-yloxyethylsulfanyl)propanoyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(2-propan-2-yloxyethylsulfanyl)propanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 167000634 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | propan-2-yl (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(2-propan-2-yloxyethylsulfanyl)propanoyl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)SCCOC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C25H35N3O5S/c1-16(2)32-11-12-34-23(13-18-15-27-21-8-6-5-7-20(18)21)24(30)28-22(10-9-19(29)14-26)25(31)33-17(3)4/h5-8,14-17,22-23,26-27H,9-13H2,1-4H3,(H,28,30)/b26-14+/t22-,23-/m0/s1 |
| InChIKey | LNXXKKIVFPGUIJ-CUAKUDOTSA-N |
| XLogP | 3.67 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|