C22H28N4O4S — CID 167000393
S-propan-2-yl (2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanethioate (PubChem CID 167000393) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is S-propan-2-yl (2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanethioate.
| Compound Name | S-propan-2-yl (2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanethioate |
|---|---|
| PubChem CID | 167000393 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | S-propan-2-yl (2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanethioate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(C)=O)C(=O)SC(C)C |
| InChI | InChI=1S/C22H28N4O4S/c1-13(2)31-22(30)19(9-8-16(28)11-23)26-21(29)20(25-14(3)27)10-15-12-24-18-7-5-4-6-17(15)18/h4-7,11-13,19-20,23-24H,8-10H2,1-3H3,(H,25,27)(H,26,29)/b23-11+/t19-,20-/m0/s1 |
| InChIKey | IMGRCCVXFOJKFK-AGHRZHCMSA-N |
| XLogP | 2.37 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|