C34H41N5O6 — CID 167000639
cyclohexyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanoyl]amino]-3-phenylpropanoate (PubChem CID 167000639) has the molecular formula C34H41N5O6 and a molecular weight of 615.73 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanoyl]amino]-3-phenylpropanoate.
| Compound Name | cyclohexyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 167000639 |
| Molecular Formula | C34H41N5O6 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.31 |
| IUPAC Name | cyclohexyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanoyl]amino]-3-phenylpropanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(C)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C34H41N5O6/c1-22(40)37-30(19-24-21-36-28-15-9-8-14-27(24)28)33(43)38-29(17-16-25(41)20-35)32(42)39-31(18-23-10-4-2-5-11-23)34(44)45-26-12-6-3-7-13-26/h2,4-5,8-11,14-15,20-21,26,29-31,35-36H,3,6-7,12-13,16-19H2,1H3,(H,37,40)(H,38,43)(H,39,42)/b35-20+/t29-,30-,31-/m0/s1 |
| InChIKey | CRXFEXVPFCJIJD-DIWLGJGXSA-N |
| XLogP | 3.30 |
| TPSA | 170.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|