C22H29N5O4S — CID 167000865
S-propan-2-yl (2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanethioate (PubChem CID 167000865) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is S-propan-2-yl (2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanethioate.
| Compound Name | S-propan-2-yl (2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanethioate |
|---|---|
| PubChem CID | 167000865 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | S-propan-2-yl (2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanethioate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CN)C(=O)SC(C)C |
| InChI | InChI=1S/C22H29N5O4S/c1-13(2)32-22(31)18(8-7-15(28)10-23)27-21(30)19(26-20(29)11-24)9-14-12-25-17-6-4-3-5-16(14)17/h3-6,10,12-13,18-19,23,25H,7-9,11,24H2,1-2H3,(H,26,29)(H,27,30)/b23-10+/t18-,19-/m0/s1 |
| InChIKey | JHVFTSLOFVYNLQ-UKEHVSJJSA-N |
| XLogP | 1.31 |
| TPSA | 158.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|