C28H33N5O4 — CID 167000170
(2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(3-methylbutanoylamino)propanoyl]amino]-5-oxo-N-phenylhexanamide (PubChem CID 167000170) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(3-methylbutanoylamino)propanoyl]amino]-5-oxo-N-phenylhexanamide.
| Compound Name | (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(3-methylbutanoylamino)propanoyl]amino]-5-oxo-N-phenylhexanamide |
|---|---|
| PubChem CID | 167000170 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(3-methylbutanoylamino)propanoyl]amino]-5-oxo-N-phenylhexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CC(C)C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H33N5O4/c1-18(2)14-26(35)32-25(15-19-17-30-23-11-7-6-10-22(19)23)28(37)33-24(13-12-21(34)16-29)27(36)31-20-8-4-3-5-9-20/h3-11,16-18,24-25,29-30H,12-15H2,1-2H3,(H,31,36)(H,32,35)(H,33,37)/b29-16+/t24-,25-/m0/s1 |
| InChIKey | BRHMBJFTWMTVHQ-UKYJPTDUSA-N |
| XLogP | 3.36 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|