C28H32N6O5 — CID 167000363
(2S)-2-[[(2S)-2-[(2-acetamidoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-N-(4-methylphenyl)-5-oxohexanamide (PubChem CID 167000363) has the molecular formula C28H32N6O5 and a molecular weight of 532.60 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(2-acetamidoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-N-(4-methylphenyl)-5-oxohexanamide.
| Compound Name | (2S)-2-[[(2S)-2-[(2-acetamidoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-N-(4-methylphenyl)-5-oxohexanamide |
|---|---|
| PubChem CID | 167000363 |
| Molecular Formula | C28H32N6O5 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(2-acetamidoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-N-(4-methylphenyl)-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(C)=O)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C28H32N6O5/c1-17-7-9-20(10-8-17)32-27(38)24(12-11-21(36)14-29)34-28(39)25(33-26(37)16-30-18(2)35)13-19-15-31-23-6-4-3-5-22(19)23/h3-10,14-15,24-25,29,31H,11-13,16H2,1-2H3,(H,30,35)(H,32,38)(H,33,37)(H,34,39)/b29-14+/t24-,25-/m0/s1 |
| InChIKey | FPLPCLILRXJFLQ-CMWXAALISA-N |
| XLogP | 1.76 |
| TPSA | 173.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|