C30H41N5O8 — CID 167000157
dipropan-2-yl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanoyl]amino]pentanedioate (PubChem CID 167000157) has the molecular formula C30H41N5O8 and a molecular weight of 599.69 g/mol. Its IUPAC name is dipropan-2-yl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanoyl]amino]pentanedioate.
| Compound Name | dipropan-2-yl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 167000157 |
| Molecular Formula | C30H41N5O8 |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | dipropan-2-yl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-6-imino-5-oxohexanoyl]amino]pentanedioate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(C)=O)C(=O)N[C@@H](CCC(=O)OC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C30H41N5O8/c1-17(2)42-27(38)13-12-25(30(41)43-18(3)4)35-28(39)24(11-10-21(37)15-31)34-29(40)26(33-19(5)36)14-20-16-32-23-9-7-6-8-22(20)23/h6-9,15-18,24-26,31-32H,10-14H2,1-5H3,(H,33,36)(H,34,40)(H,35,39)/b31-15+/t24-,25-,26-/m0/s1 |
| InChIKey | AQBSJVMOBQIBED-NOWIZYIRSA-N |
| XLogP | 1.87 |
| TPSA | 196.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|