C23H30N4O4S — CID 167000660
S-propan-2-yl (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(oxetan-3-ylamino)propanoyl]amino]-5-oxohexanethioate (PubChem CID 167000660) has the molecular formula C23H30N4O4S and a molecular weight of 458.58 g/mol. Its IUPAC name is S-propan-2-yl (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(oxetan-3-ylamino)propanoyl]amino]-5-oxohexanethioate.
| Compound Name | S-propan-2-yl (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(oxetan-3-ylamino)propanoyl]amino]-5-oxohexanethioate |
|---|---|
| PubChem CID | 167000660 |
| Molecular Formula | C23H30N4O4S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | S-propan-2-yl (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(oxetan-3-ylamino)propanoyl]amino]-5-oxohexanethioate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC1COC1)C(=O)SC(C)C |
| InChI | InChI=1S/C23H30N4O4S/c1-14(2)32-23(30)20(8-7-17(28)10-24)27-22(29)21(26-16-12-31-13-16)9-15-11-25-19-6-4-3-5-18(15)19/h3-6,10-11,14,16,20-21,24-26H,7-9,12-13H2,1-2H3,(H,27,29)/b24-10+/t20-,21-/m0/s1 |
| InChIKey | ZSTMPRTUDOWRHO-QRQYZTNLSA-N |
| XLogP | 2.22 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|