C23H29N5O6 — CID 167000698
(2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-[(2-morpholin-4-yl-2-oxoethyl)amino]propanoyl]amino]-5-oxohexanoic acid (PubChem CID 167000698) has the molecular formula C23H29N5O6 and a molecular weight of 471.51 g/mol. Its IUPAC name is (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-[(2-morpholin-4-yl-2-oxoethyl)amino]propanoyl]amino]-5-oxohexanoic acid.
| Compound Name | (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-[(2-morpholin-4-yl-2-oxoethyl)amino]propanoyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 167000698 |
| Molecular Formula | C23H29N5O6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-[(2-morpholin-4-yl-2-oxoethyl)amino]propanoyl]amino]-5-oxohexanoic acid |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NCC(=O)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C23H29N5O6/c24-12-16(29)5-6-19(23(32)33)27-22(31)20(26-14-21(30)28-7-9-34-10-8-28)11-15-13-25-18-4-2-1-3-17(15)18/h1-4,12-13,19-20,24-26H,5-11,14H2,(H,27,31)(H,32,33)/b24-12+/t19-,20-/m0/s1 |
| InChIKey | ODQYCLGXNVICRN-DNBIEOLWSA-N |
| XLogP | 0.10 |
| TPSA | 164.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|