C20H24N4O5 — CID 167000693
(2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(oxetan-3-ylamino)propanoyl]amino]-5-oxohexanoic acid (PubChem CID 167000693) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(oxetan-3-ylamino)propanoyl]amino]-5-oxohexanoic acid.
| Compound Name | (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(oxetan-3-ylamino)propanoyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 167000693 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (2S)-6-imino-2-[[(2S)-3-(1H-indol-3-yl)-2-(oxetan-3-ylamino)propanoyl]amino]-5-oxohexanoic acid |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC1COC1)C(=O)O |
| InChI | InChI=1S/C20H24N4O5/c21-8-14(25)5-6-17(20(27)28)24-19(26)18(23-13-10-29-11-13)7-12-9-22-16-4-2-1-3-15(12)16/h1-4,8-9,13,17-18,21-23H,5-7,10-11H2,(H,24,26)(H,27,28)/b21-8+/t17-,18-/m0/s1 |
| InChIKey | UHFWQQMLKJDQKK-UOBQVVGJSA-N |
| XLogP | 0.64 |
| TPSA | 144.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|