C22H26N4O5 — CID 167015168
propan-2-yl (2S)-2-[[(2S)-3-(5-cyano-1H-indol-3-yl)-2-methoxypropanoyl]amino]-6-imino-5-oxohexanoate (PubChem CID 167015168) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2S)-3-(5-cyano-1H-indol-3-yl)-2-methoxypropanoyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2S)-3-(5-cyano-1H-indol-3-yl)-2-methoxypropanoyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 167015168 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2S)-3-(5-cyano-1H-indol-3-yl)-2-methoxypropanoyl]amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccc(C#N)cc12)OC)C(=O)OC(C)C |
| InChI | InChI=1S/C22H26N4O5/c1-13(2)31-22(29)19(7-5-16(27)11-24)26-21(28)20(30-3)9-15-12-25-18-6-4-14(10-23)8-17(15)18/h4,6,8,11-13,19-20,24-25H,5,7,9H2,1-3H3,(H,26,28)/b24-11+/t19-,20-/m0/s1 |
| InChIKey | FZCFBUMESMVRAM-BJVRADTLSA-N |
| XLogP | 2.03 |
| TPSA | 145.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|