C15H26N2O5 — CID 167014874
propan-2-yl (2S)-6-imino-2-[[(2S)-2-methoxypentanoyl]amino]-5-oxohexanoate (PubChem CID 167014874) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is propan-2-yl (2S)-6-imino-2-[[(2S)-2-methoxypentanoyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-imino-2-[[(2S)-2-methoxypentanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 167014874 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | propan-2-yl (2S)-6-imino-2-[[(2S)-2-methoxypentanoyl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](CCC)OC)C(=O)OC(C)C |
| InChI | InChI=1S/C15H26N2O5/c1-5-6-13(21-4)14(19)17-12(8-7-11(18)9-16)15(20)22-10(2)3/h9-10,12-13,16H,5-8H2,1-4H3,(H,17,19)/b16-9+/t12-,13-/m0/s1 |
| InChIKey | COCCIAVIZCITFU-CSBKXELUSA-N |
| XLogP | 1.24 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|