C14H24N2O4S — CID 167014909
propan-2-yl (2S)-6-imino-2-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]-5-oxohexanoate (PubChem CID 167014909) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is propan-2-yl (2S)-6-imino-2-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-imino-2-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 167014909 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | propan-2-yl (2S)-6-imino-2-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H](S)C(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C14H24N2O4S/c1-8(2)12(21)13(18)16-11(6-5-10(17)7-15)14(19)20-9(3)4/h7-9,11-12,15,21H,5-6H2,1-4H3,(H,16,18)/b15-7+/t11-,12-/m0/s1 |
| InChIKey | JAWWBBBKYCDGDR-WVVQMSQFSA-N |
| XLogP | 1.38 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|