C13H20N2O5 — CID 167015705
propan-2-yl (2S)-6-imino-2-[[(2R)-oxetane-2-carbonyl]amino]-5-oxohexanoate (PubChem CID 167015705) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is propan-2-yl (2S)-6-imino-2-[[(2R)-oxetane-2-carbonyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-imino-2-[[(2R)-oxetane-2-carbonyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 167015705 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | propan-2-yl (2S)-6-imino-2-[[(2R)-oxetane-2-carbonyl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H]1CCO1)C(=O)OC(C)C |
| InChI | InChI=1S/C13H20N2O5/c1-8(2)20-13(18)10(4-3-9(16)7-14)15-12(17)11-5-6-19-11/h7-8,10-11,14H,3-6H2,1-2H3,(H,15,17)/b14-7+/t10-,11+/m0/s1 |
| InChIKey | BUPIJMRXOMOGGC-QQUKIDOTSA-N |
| XLogP | 0.21 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|