C15H26N4O5 — CID 166105919
propan-2-yl 2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate (PubChem CID 166105919) has the molecular formula C15H26N4O5 and a molecular weight of 342.40 g/mol. Its IUPAC name is propan-2-yl 2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | propan-2-yl 2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 166105919 |
| Molecular Formula | C15H26N4O5 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | propan-2-yl 2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CCC(NC(=O)CNC(=O)CN(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C15H26N4O5/c1-10(2)24-15(23)12(6-5-11(20)7-16)18-13(21)8-17-14(22)9-19(3)4/h7,10,12,16H,5-6,8-9H2,1-4H3,(H,17,22)(H,18,21)/b16-7+ |
| InChIKey | SRTCHSYKLYXKQO-FRKPEAEDSA-N |
| XLogP | -0.90 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|