C26H39N5O5 — CID 166105936
tert-butyl (2S)-2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;1,3-dimethylindole (PubChem CID 166105936) has the molecular formula C26H39N5O5 and a molecular weight of 501.63 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;1,3-dimethylindole.
| Compound Name | tert-butyl (2S)-2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;1,3-dimethylindole |
|---|---|
| PubChem CID | 166105936 |
| Molecular Formula | C26H39N5O5 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | tert-butyl (2S)-2-[[2-[[2-(dimethylamino)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;1,3-dimethylindole |
| SMILES | Cc1cn(C)c2ccccc12.[H]/N=C/C(=O)CC[C@H](NC(=O)CNC(=O)CN(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N4O5.C10H11N/c1-16(2,3)25-15(24)12(7-6-11(21)8-17)19-13(22)9-18-14(23)10-20(4)5;1-8-7-11(2)10-6-4-3-5-9(8)10/h8,12,17H,6-7,9-10H2,1-5H3,(H,18,23)(H,19,22);3-7H,1-2H3/b17-8+;/t12-;/m0./s1 |
| InChIKey | BLYUQUNINCHOMF-GLRNRXMZSA-N |
| XLogP | 1.98 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|